Показать сокращенную информацию
| dc.contributor.author | Safin D. | |
| dc.contributor.author | Sokolov F. | |
| dc.contributor.author | Baranov S. | |
| dc.contributor.author | Szyrwiel Ł. | |
| dc.contributor.author | Babashkina M. | |
| dc.contributor.author | Shakirova E. | |
| dc.contributor.author | Hahn F. | |
| dc.contributor.author | Kozlowski H. | |
| dc.date.accessioned | 2018-09-18T20:32:22Z | |
| dc.date.available | 2018-09-18T20:32:22Z | |
| dc.date.issued | 2008 | |
| dc.identifier.issn | 0044-2313 | |
| dc.identifier.uri | https://dspace.kpfu.ru/xmlui/handle/net/140929 | |
| dc.description.abstract | Reaction of the potassium salt of N-diisopropoxyphosphinyl-p- bromothiobenzamide p-BrC6H4C(S)NHP(O)(OiPr)2 (HL) with Ni(NO3)2 in aqueous EtOH leads to complex of formula [Ni(HL-O)2(L-O,S)2] (1). The structure of 1 was investigated by single crystal X-ray diffraction analysis, IR, 1H and 31P{1H} NMR spectroscopy, MALDI and microanalysis. The nickel(II) ion in 1 has a tetragonal-bipyramidal environment, (O ax)2(Oeq)2(Seq) 2, with two neutral ligand molecules coordinated in axial positions through the oxygen atoms of the P=O groups. The equatorial plane of bipyramide is formed by two anionic ligands involving 1,5-O,S-coordination mode. The chelating ligands are bound in trans configuration. © 2008 Wiley-VCH Verlag GmbH & Co. KGaA. | |
| dc.relation.ispartofseries | Zeitschrift fur Anorganische und Allgemeine Chemie | |
| dc.subject | Amidophosphate | |
| dc.subject | Chelates | |
| dc.subject | Crystal structure | |
| dc.subject | Nickel | |
| dc.title | Coordination mode of the nickel(II) cation with N-diisopropoxyphosphinyl-p- bromothiobenzamide | |
| dc.type | Article | |
| dc.relation.ispartofseries-issue | 5 | |
| dc.relation.ispartofseries-volume | 634 | |
| dc.collection | Публикации сотрудников КФУ | |
| dc.relation.startpage | 835 | |
| dc.source.id | SCOPUS00442313-2008-634-5-SID53849088565 |