Показать сокращенную информацию
dc.contributor.author | Safin D. | |
dc.contributor.author | Mlynarz P. | |
dc.contributor.author | Ekkehardt Hahn F. | |
dc.contributor.author | Babashkina M. | |
dc.contributor.author | Sokolov F. | |
dc.contributor.author | Zabirov N. | |
dc.contributor.author | Galezowska J. | |
dc.contributor.author | Kozlowski H. | |
dc.date.accessioned | 2018-09-18T20:32:21Z | |
dc.date.available | 2018-09-18T20:32:21Z | |
dc.date.issued | 2007 | |
dc.identifier.issn | 0044-2313 | |
dc.identifier.uri | https://dspace.kpfu.ru/xmlui/handle/net/140927 | |
dc.description.abstract | Structure and magnetic properties of N-diisopropoxyphosphorylthiobenzamide PhC(S)-N(H)-P(O)(OiPr) 2 (HL I) and N- diisopropoxyphosphoryl-N′-phenylthiocarbamide PhN(H)-C(S)-N(H)-P(O)(OiPr) 2 (HL II) complexes with the Co II cation of formulas [Co {PhC(S)-N-P(O)(OiPr) 2} 2] (1), [Co(PhN(H)-C(S)-N-P(O)(OiPr) 2] 2] (2), [Co{PhC(S)-N(H)-P(O) (OiPr) 2} 2{PhC(S)-N-P(O)(OiPr) 2} 2] (1a) and [Co{PhC(S)-N-P(O)(OiPr) 2} 2}(2,2′-bipy)] (3), [Co{PhC(S)-N-P(O)(OiPr) 2} 2(1,10-phen)] (4), [Co{PhN(H)-C(S)-N-P(O)(OiPr) 2] 2(2,2′-bipy)] (5), [Co(PhN(H)-C(S)-N-P(O)(OiPr) 2} 2(1,10-phen)] (6) were investigated. Paramagnetic shifts in the 1H NMR spectrum were observed for high-spin Co II complexes with HL I,II, incorporating the S-C-N-P-O chelate moiety and two aromatic chelate ligands. Investigation of the thermal dependence of the magnetic susceptibility has shown that the extended materials 1-2 and 6 show ferromagnetic exchange between distorted tetrahedral (1, 2) or octahedral (la, 6) metal atoms whereas 3 and 5 show antiferromagnetic properties. Compound 4 behaves as a spin-canted ferromagnet, an antiferromagnetic ordering taking place below a critical temperature, T c = 115 K. Complexes 1 and 1a were investigated by single crystal X-ray diffraction. The cobalt(II) atom in complex 1 resides a distorted tetrahedral O 2S 2 environment formed by the C=S sulfur atoms and the P=O oxygen atoms of two deprotonated ligands. Complex la has a tetragonal-bipyramidal structure, Co(O ax) 2(O eq) 2(S eq) 2, and two neutral ligand molecules are coordinated in the axial positions through the oxygen atoms of the P=O groups. The base of the bipyramid is formed by two anionic ligands in the typical 1,5-O,S coordination mode. The ligands are in a trans configuration. © 2007 WILEY-VCH Verlag GmbH & Co. KGaA. | |
dc.relation.ispartofseries | Zeitschrift fur Anorganische und Allgemeine Chemie | |
dc.subject | Amidophosphates | |
dc.subject | Chelate | |
dc.subject | Cobalt | |
dc.subject | Magnetic properties | |
dc.subject | NMR spectroscopy | |
dc.title | Cobalt(II) complexes with N-thioacylamidophosphates and 2,2′-bipyridyl and 1,10-phenathroline. Crystal structures, solution 11H NMR spectral and magnetic properties | |
dc.type | Article | |
dc.relation.ispartofseries-issue | 9 | |
dc.relation.ispartofseries-volume | 633 | |
dc.collection | Публикации сотрудников КФУ | |
dc.relation.startpage | 1472 | |
dc.source.id | SCOPUS00442313-2007-633-9-SID34547213335 |