Показать сокращенную информацию
| dc.contributor.author | Kadkin O. | |
| dc.contributor.author | Galyametdinov Y. | |
| dc.contributor.author | Rakhmatullin A. | |
| dc.contributor.author | Mavrin V. | |
| dc.date.accessioned | 2018-09-17T21:17:26Z | |
| dc.date.available | 2018-09-17T21:17:26Z | |
| dc.date.issued | 1999 | |
| dc.identifier.issn | 1066-5285 | |
| dc.identifier.uri | https://dspace.kpfu.ru/xmlui/handle/net/134791 | |
| dc.description.abstract | New liquid-crystalline heteropolynuclear complexes L2M (M = Cu2+ (2a), Pd2+ (2b)) were synthesized by the reactions of C5H5FeC5H4-C6H4NH-C2H2-(CO)-C6H4OC12H25 (1, LH) with copper(II) and palladium(II) acetates. Compound 2b was found to possess monotropic nematic and smectic phases; 2a exhibits the monotropic nematic phase and a phenomenon of "double melting." The compositions and structures of compounds 1 and 2a,b were established by elemental analysis, 1H and 13C NMR, ESR, and IR spectroscopy. | |
| dc.relation.ispartofseries | Russian Chemical Bulletin | |
| dc.subject | Coordination compounds | |
| dc.subject | Ferrocene | |
| dc.subject | Liquid crystals | |
| dc.subject | Metallomesogens | |
| dc.title | Liquid-crystalline CuII and PdII complexes with nonmesogenic ferrocene-containing β-aminovinyl ketone | |
| dc.type | Article | |
| dc.relation.ispartofseries-issue | 2 | |
| dc.relation.ispartofseries-volume | 48 | |
| dc.collection | Публикации сотрудников КФУ | |
| dc.relation.startpage | 381 | |
| dc.source.id | SCOPUS10665285-1999-48-2-SID0033473061 |