dc.contributor.author |
Kadkin O. |
|
dc.contributor.author |
Galyametdinov Y. |
|
dc.contributor.author |
Rakhmatullin A. |
|
dc.contributor.author |
Mavrin V. |
|
dc.date.accessioned |
2018-09-17T21:17:26Z |
|
dc.date.available |
2018-09-17T21:17:26Z |
|
dc.date.issued |
1999 |
|
dc.identifier.issn |
1066-5285 |
|
dc.identifier.uri |
https://dspace.kpfu.ru/xmlui/handle/net/134791 |
|
dc.description.abstract |
New liquid-crystalline heteropolynuclear complexes L2M (M = Cu2+ (2a), Pd2+ (2b)) were synthesized by the reactions of C5H5FeC5H4-C6H4NH-C2H2-(CO)-C6H4OC12H25 (1, LH) with copper(II) and palladium(II) acetates. Compound 2b was found to possess monotropic nematic and smectic phases; 2a exhibits the monotropic nematic phase and a phenomenon of "double melting." The compositions and structures of compounds 1 and 2a,b were established by elemental analysis, 1H and 13C NMR, ESR, and IR spectroscopy. |
|
dc.relation.ispartofseries |
Russian Chemical Bulletin |
|
dc.subject |
Coordination compounds |
|
dc.subject |
Ferrocene |
|
dc.subject |
Liquid crystals |
|
dc.subject |
Metallomesogens |
|
dc.title |
Liquid-crystalline CuII and PdII complexes with nonmesogenic ferrocene-containing β-aminovinyl ketone |
|
dc.type |
Article |
|
dc.relation.ispartofseries-issue |
2 |
|
dc.relation.ispartofseries-volume |
48 |
|
dc.collection |
Публикации сотрудников КФУ |
|
dc.relation.startpage |
381 |
|
dc.source.id |
SCOPUS10665285-1999-48-2-SID0033473061 |
|